C8H7FN4S — CID 106515856
5-fluoro-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-2-thione (PubChem CID 106515856) has the molecular formula C8H7FN4S and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-fluoro-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-2-thione.
| Compound Name | 5-fluoro-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 106515856 |
| Molecular Formula | C8H7FN4S |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 5-fluoro-6-(1-methylpyrazol-4-yl)-1H-pyrimidine-2-thione |
| SMILES | Cn1cc(-c2[nH]c(=S)ncc2F)cn1 |
| InChI | InChI=1S/C8H7FN4S/c1-13-4-5(2-11-13)7-6(9)3-10-8(14)12-7/h2-4H,1H3,(H,10,12,14) |
| InChIKey | NHRNPOFLMZDNDG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|