C12H11FN2O — CID 106516880
6-(2,4-dimethylphenyl)-5-fluoro-1H-pyrimidin-2-one (PubChem CID 106516880) has the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-5-fluoro-1H-pyrimidin-2-one.
| Compound Name | 6-(2,4-dimethylphenyl)-5-fluoro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 106516880 |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-5-fluoro-1H-pyrimidin-2-one |
| SMILES | Cc1ccc(-c2[nH]c(=O)ncc2F)c(C)c1 |
| InChI | InChI=1S/C12H11FN2O/c1-7-3-4-9(8(2)5-7)11-10(13)6-14-12(16)15-11/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | KEMRRQODOCKIRF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |