About CID 10651702
CID 10651702 (PubChem CID 10651702) has the molecular formula C30H22Cl2N4O4S2
and a molecular weight of 637.57 g/mol.
Molecular Properties
| Compound Name | CID 10651702 |
| PubChem CID | 10651702 |
| Molecular Formula | C30H22Cl2N4O4S2 |
| Molecular Weight | 637.57 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | — |
| SMILES | O=S(=O)(c1ccccc1)c1cc2c(cc1Cl)=NC1(CCC3(CC1)N=c1cc(Cl)c(S(=O)(=O)c4ccccc4)cc1=N3)N=2 |
| InChI | InChI=1S/C30H22Cl2N4O4S2/c31-21-15-23-25(17-27(21)41(37,38)19-7-3-1-4-8-19)35-29(33-23)11-13-30(14-12-29)34-24-16-22(32)28(18-26(24)36-30)42(39,40)20-9-5-2-6-10-20/h1-10,15-18H,11-14H2 |
| InChIKey | WWTQFVHSYHWGFC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 637.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 10651702 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10651702?
The IUPAC name of CID 10651702 (CID 10651702) is not available.
What is the SMILES notation for CID 10651702?
The canonical SMILES for CID 10651702 is O=S(=O)(c1ccccc1)c1cc2c(cc1Cl)=NC1(CCC3(CC1)N=c1cc(Cl)c(S(=O)(=O)c4ccccc4)cc1=N3)N=2.
What is the InChIKey of CID 10651702?
The InChIKey is WWTQFVHSYHWGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22Cl2N4O4S2/c31-21-15-23-25(17-27(21)41(37,38)19-7-3-1-4-8-19)35-29(33-23)11-13-30(14-12-29)34-24-16-22(32)28(18-26(24)36-30)42(39,40)20-9-5-2-6-10-20/h1-10,15-18H,11-14H2.
What are the key properties of CID 10651702?
CID 10651702 has a molecular weight of 637.57 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10651702 is sourced from PubChem (CID 10651702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).