About 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione
4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione (PubChem CID 106517660) has the molecular formula C12H5F6NS
and a molecular weight of 309.23 g/mol. Its IUPAC name is 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione |
| PubChem CID | 106517660 |
| Molecular Formula | C12H5F6NS |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione |
| SMILES | Fc1ccc(-c2cc(C(F)(F)F)cc(=S)[nH]2)c(F)c1F |
| InChI | InChI=1S/C12H5F6NS/c13-7-2-1-6(10(14)11(7)15)8-3-5(12(16,17)18)4-9(20)19-8/h1-4H,(H,19,20) |
| InChIKey | MBYIVBPYDQULRP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione?
The IUPAC name of 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione (CID 106517660) is 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione.
What is the SMILES notation for 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione?
The canonical SMILES for 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione is Fc1ccc(-c2cc(C(F)(F)F)cc(=S)[nH]2)c(F)c1F.
What is the InChIKey of 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione?
The InChIKey is MBYIVBPYDQULRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5F6NS/c13-7-2-1-6(10(14)11(7)15)8-3-5(12(16,17)18)4-9(20)19-8/h1-4H,(H,19,20).
What are the key properties of 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione?
4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione has a molecular weight of 309.23 g/mol, XLogP of 4.85, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-6-(2,3,4-trifluorophenyl)-1H-pyridine-2-thione is sourced from PubChem (CID 106517660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).