C10H5F3N2O — CID 106517664
3-(2,3,4-trifluorophenyl)-1H-pyrazin-2-one (PubChem CID 106517664) has the molecular formula C10H5F3N2O and a molecular weight of 226.16 g/mol. Its IUPAC name is 3-(2,3,4-trifluorophenyl)-1H-pyrazin-2-one.
| Compound Name | 3-(2,3,4-trifluorophenyl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 106517664 |
| Molecular Formula | C10H5F3N2O |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 3-(2,3,4-trifluorophenyl)-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H5F3N2O/c11-6-2-1-5(7(12)8(6)13)9-10(16)15-4-3-14-9/h1-4H,(H,15,16) |
| InChIKey | IOEZCIUROISHTC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|