About 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione
5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione (PubChem CID 106518441) has the molecular formula C16H20N2S
and a molecular weight of 272.42 g/mol. Its IUPAC name is 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione |
| PubChem CID | 106518441 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(C)c(-c2[nH]cnc(=S)c2C(C)C)cc1C |
| InChI | InChI=1S/C16H20N2S/c1-9(2)14-15(17-8-18-16(14)19)13-7-11(4)10(3)6-12(13)5/h6-9H,1-5H3,(H,17,18,19) |
| InChIKey | UPWBWYIILMJEIY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione?
The IUPAC name of 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione (CID 106518441) is 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione.
What is the SMILES notation for 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione?
The canonical SMILES for 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione is Cc1cc(C)c(-c2[nH]cnc(=S)c2C(C)C)cc1C.
What is the InChIKey of 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione?
The InChIKey is UPWBWYIILMJEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2S/c1-9(2)14-15(17-8-18-16(14)19)13-7-11(4)10(3)6-12(13)5/h6-9H,1-5H3,(H,17,18,19).
What are the key properties of 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione?
5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione has a molecular weight of 272.42 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione is sourced from PubChem (CID 106518441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).