C16H20N2S — CID 106518441
5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione (PubChem CID 106518441) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106518441 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-propan-2-yl-6-(2,4,5-trimethylphenyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(C)c(-c2[nH]cnc(=S)c2C(C)C)cc1C |
| InChI | InChI=1S/C16H20N2S/c1-9(2)14-15(17-8-18-16(14)19)13-7-11(4)10(3)6-12(13)5/h6-9H,1-5H3,(H,17,18,19) |
| InChIKey | UPWBWYIILMJEIY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|