C7H6N2OS2 — CID 106518530
5-(5-methylthiophen-3-yl)-3H-1,3,4-thiadiazol-2-one (PubChem CID 106518530) has the molecular formula C7H6N2OS2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-(5-methylthiophen-3-yl)-3H-1,3,4-thiadiazol-2-one.
| Compound Name | 5-(5-methylthiophen-3-yl)-3H-1,3,4-thiadiazol-2-one |
|---|---|
| PubChem CID | 106518530 |
| Molecular Formula | C7H6N2OS2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 5-(5-methylthiophen-3-yl)-3H-1,3,4-thiadiazol-2-one |
| SMILES | Cc1cc(-c2n[nH]c(=O)s2)cs1 |
| InChI | InChI=1S/C7H6N2OS2/c1-4-2-5(3-11-4)6-8-9-7(10)12-6/h2-3H,1H3,(H,9,10) |
| InChIKey | JEDGLDHUQSJYTP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |