C31H68O3Si2Sn — CID 10651995
(E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-tributylstannylhept-6-en-1-ol (PubChem CID 10651995) has the molecular formula C31H68O3Si2Sn and a molecular weight of 663.76 g/mol. Its IUPAC name is (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-tributylstannylhept-6-en-1-ol.
| Compound Name | (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-tributylstannylhept-6-en-1-ol |
|---|---|
| PubChem CID | 10651995 |
| Molecular Formula | C31H68O3Si2Sn |
| Molecular Weight | 663.76 g/mol |
| Exact Mass | 664.37 |
| IUPAC Name | (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-tributylstannylhept-6-en-1-ol |
| SMILES | CCCC[Sn](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCO)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C19H41O3Si2.3C4H9.Sn/c1-12-16(21-23(8,9)18(2,3)4)17(14-13-15-20)22-24(10,11)19(5,6)7;3*1-3-4-2;/h1,12,16-17,20H,13-15H2,2-11H3;3*1,3-4H2,2H3;/t16-,17+;;;;/m1..../s1 |
| InChIKey | LZESYDYNDVVMGW-PNNYBRIFSA-N |
| XLogP | 10.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.76 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|