C13H12ClFN2OS — CID 106521030
6-(3-chloro-4-fluorophenyl)-2-(ethoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106521030) has the molecular formula C13H12ClFN2OS and a molecular weight of 298.77 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-2-(ethoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(3-chloro-4-fluorophenyl)-2-(ethoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106521030 |
| Molecular Formula | C13H12ClFN2OS |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-2-(ethoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CCOCc1nc(=S)cc(-c2ccc(F)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C13H12ClFN2OS/c1-2-18-7-12-16-11(6-13(19)17-12)8-3-4-10(15)9(14)5-8/h3-6H,2,7H2,1H3,(H,16,17,19) |
| InChIKey | MVATUNBIEPQBGB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|