C41H40O7S — CID 10652115
[(1R,2R,3S,4R,5S,6R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxy-phenoxymethanethione (PubChem CID 10652115) has the molecular formula C41H40O7S and a molecular weight of 676.83 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5S,6R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxy-phenoxymethanethione.
| Compound Name | [(1R,2R,3S,4R,5S,6R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxy-phenoxymethanethione |
|---|---|
| PubChem CID | 10652115 |
| Molecular Formula | C41H40O7S |
| Molecular Weight | 676.83 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | [(1R,2R,3S,4R,5S,6R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl]oxy-phenoxymethanethione |
| SMILES | OC1[C@@H](OC(=S)Oc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H40O7S/c42-35-36(43-26-30-16-6-1-7-17-30)38(44-27-31-18-8-2-9-19-31)40(46-29-33-22-12-4-13-23-33)39(45-28-32-20-10-3-11-21-32)37(35)48-41(49)47-34-24-14-5-15-25-34/h1-25,35-40,42H,26-29H2/t35?,36-,37+,38+,39-,40-/m0/s1 |
| InChIKey | SKQLQFLARKHHQL-CICRWGSQSA-N |
| XLogP | 7.45 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.83 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|