C12H13N3O3S — CID 106521207
2-(2,3-dimethoxyphenyl)-6-methoxy-1H-1,3,5-triazine-4-thione (PubChem CID 106521207) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-6-methoxy-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-(2,3-dimethoxyphenyl)-6-methoxy-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 106521207 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-6-methoxy-1H-1,3,5-triazine-4-thione |
| SMILES | COc1nc(=S)nc(-c2cccc(OC)c2OC)[nH]1 |
| InChI | InChI=1S/C12H13N3O3S/c1-16-8-6-4-5-7(9(8)17-2)10-13-11(18-3)15-12(19)14-10/h4-6H,1-3H3,(H,13,14,15,19) |
| InChIKey | QJUIFVYYVAIBAJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|