C17H22N2S — CID 106522105
6-[3-(2-methylpropyl)phenyl]-2-propyl-1H-pyrimidine-4-thione (PubChem CID 106522105) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 6-[3-(2-methylpropyl)phenyl]-2-propyl-1H-pyrimidine-4-thione.
| Compound Name | 6-[3-(2-methylpropyl)phenyl]-2-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106522105 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 6-[3-(2-methylpropyl)phenyl]-2-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1nc(=S)cc(-c2cccc(CC(C)C)c2)[nH]1 |
| InChI | InChI=1S/C17H22N2S/c1-4-6-16-18-15(11-17(20)19-16)14-8-5-7-13(10-14)9-12(2)3/h5,7-8,10-12H,4,6,9H2,1-3H3,(H,18,19,20) |
| InChIKey | PKBBCXPDTMYCDQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|