C40H68N8O2 — CID 10652251
14,30,35,41-tetramethyl-1,11,14,17,27,30,35,41-octazapentacyclo[25.5.5.511,17.14,8.120,24]tetratetraconta-4(44),5,7,20,22,24(38)-hexaene-38,44-diol (PubChem CID 10652251) has the molecular formula C40H68N8O2 and a molecular weight of 693.04 g/mol. Its IUPAC name is 14,30,35,41-tetramethyl-1,11,14,17,27,30,35,41-octazapentacyclo[25.5.5.511,17.14,8.120,24]tetratetraconta-4(44),5,7,20,22,24(38)-hexaene-38,44-diol.
| Compound Name | 14,30,35,41-tetramethyl-1,11,14,17,27,30,35,41-octazapentacyclo[25.5.5.511,17.14,8.120,24]tetratetraconta-4(44),5,7,20,22,24(38)-hexaene-38,44-diol |
|---|---|
| PubChem CID | 10652251 |
| Molecular Formula | C40H68N8O2 |
| Molecular Weight | 693.04 g/mol |
| Exact Mass | 692.55 |
| IUPAC Name | 14,30,35,41-tetramethyl-1,11,14,17,27,30,35,41-octazapentacyclo[25.5.5.511,17.14,8.120,24]tetratetraconta-4(44),5,7,20,22,24(38)-hexaene-38,44-diol |
| SMILES | CN1CCN2CCc3cccc(c3O)CCN3CCN(C)CCN(CCc4cccc(c4O)CCN(CC1)CCN(C)CC2)CCN(C)CC3 |
| InChI | InChI=1S/C40H68N8O2/c1-41-19-27-45-15-11-35-7-5-9-37(39(35)49)13-17-47-31-23-43(3)24-32-48(34-26-44(4)25-33-47)18-14-38-10-6-8-36(40(38)50)12-16-46(28-20-41)30-22-42(2)21-29-45/h5-10,49-50H,11-34H2,1-4H3 |
| InChIKey | DFPYBPQBEPUFAZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.04 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |