About 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile
2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile (PubChem CID 106523239) has the molecular formula C10H8ClF3N2
and a molecular weight of 248.64 g/mol. Its IUPAC name is 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile |
| PubChem CID | 106523239 |
| Molecular Formula | C10H8ClF3N2 |
| Molecular Weight | 248.64 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile |
| SMILES | CC(C#N)(Nc1ccccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3N2/c1-9(6-15,10(12,13)14)16-8-5-3-2-4-7(8)11/h2-5,16H,1H3 |
| InChIKey | RRQMHQRGMKIPDK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile?
The IUPAC name of 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile (CID 106523239) is 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile.
What is the SMILES notation for 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile?
The canonical SMILES for 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile is CC(C#N)(Nc1ccccc1Cl)C(F)(F)F.
What is the InChIKey of 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile?
The InChIKey is RRQMHQRGMKIPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClF3N2/c1-9(6-15,10(12,13)14)16-8-5-3-2-4-7(8)11/h2-5,16H,1H3.
What are the key properties of 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile?
2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile has a molecular weight of 248.64 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroanilino)-3,3,3-trifluoro-2-methylpropanenitrile is sourced from PubChem (CID 106523239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).