C20H26N6O14P2Se — CID 10652408
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(4-carbamoylselenophen-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 10652408) has the molecular formula C20H26N6O14P2Se and a molecular weight of 715.36 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(4-carbamoylselenophen-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(4-carbamoylselenophen-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 10652408 |
| Molecular Formula | C20H26N6O14P2Se |
| Molecular Weight | 715.36 g/mol |
| Exact Mass | 716.01 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(4-carbamoylselenophen-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | NC(=O)c1c[se]c([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C20H26N6O14P2Se/c21-17-11-19(24-5-23-17)26(6-25-11)20-15(30)13(28)9(39-20)3-37-42(34,35)40-41(32,33)36-2-8-12(27)14(29)16(38-8)10-1-7(4-43-10)18(22)31/h1,4-6,8-9,12-16,20,27-30H,2-3H2,(H2,22,31)(H,32,33)(H,34,35)(H2,21,23,24)/t8-,9-,12-,13-,14-,15-,16+,20-/m1/s1 |
| InChIKey | YULSESLRMNNQOO-FAAWYDDFSA-N |
| XLogP | -2.70 |
| TPSA | 314.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.36 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|