C12H10FN3OS2 — CID 106525636
2-[[3-[(3-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile (PubChem CID 106525636) has the molecular formula C12H10FN3OS2 and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[[3-[(3-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile.
| Compound Name | 2-[[3-[(3-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
|---|---|
| PubChem CID | 106525636 |
| Molecular Formula | C12H10FN3OS2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-[[3-[(3-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
| SMILES | N#CCSCc1nc(CSc2cccc(F)c2)no1 |
| InChI | InChI=1S/C12H10FN3OS2/c13-9-2-1-3-10(6-9)19-7-11-15-12(17-16-11)8-18-5-4-14/h1-3,6H,5,7-8H2 |
| InChIKey | UOVZPQIYLVRFGS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|