About 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile
2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile (PubChem CID 106526668) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile |
| PubChem CID | 106526668 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile |
| SMILES | COC(C)Cc1noc(CC#N)n1 |
| InChI | InChI=1S/C8H11N3O2/c1-6(12-2)5-7-10-8(3-4-9)13-11-7/h6H,3,5H2,1-2H3 |
| InChIKey | ZSOGICDXAJJSQG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile?
The IUPAC name of 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile (CID 106526668) is 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile.
What is the SMILES notation for 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile?
The canonical SMILES for 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile is COC(C)Cc1noc(CC#N)n1.
What is the InChIKey of 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile?
The InChIKey is ZSOGICDXAJJSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-6(12-2)5-7-10-8(3-4-9)13-11-7/h6H,3,5H2,1-2H3.
What are the key properties of 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile?
2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile has a molecular weight of 181.19 g/mol, XLogP of 0.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-methoxypropyl)-1,2,4-oxadiazol-5-yl]acetonitrile is sourced from PubChem (CID 106526668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).