C10H11F4N3O2 — CID 106528007
2-methyl-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]propanenitrile (PubChem CID 106528007) has the molecular formula C10H11F4N3O2 and a molecular weight of 281.21 g/mol. Its IUPAC name is 2-methyl-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]propanenitrile.
| Compound Name | 2-methyl-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]propanenitrile |
|---|---|
| PubChem CID | 106528007 |
| Molecular Formula | C10H11F4N3O2 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-methyl-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)-1,2,4-oxadiazol-5-yl]propanenitrile |
| SMILES | CC(C#N)Cc1nc(COCC(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C10H11F4N3O2/c1-6(3-15)2-8-16-7(17-19-8)4-18-5-10(13,14)9(11)12/h6,9H,2,4-5H2,1H3 |
| InChIKey | BAXUHBHSHKVFST-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|