C12H13ClN4O3 — CID 106528178
3-[(5-chloropyrazin-2-yl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 106528178) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 3-[(5-chloropyrazin-2-yl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(5-chloropyrazin-2-yl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 106528178 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-[(5-chloropyrazin-2-yl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCOCC2)C(=O)N1Cc1cnc(Cl)cn1 |
| InChI | InChI=1S/C12H13ClN4O3/c13-9-6-14-8(5-15-9)7-17-10(18)12(16-11(17)19)1-3-20-4-2-12/h5-6H,1-4,7H2,(H,16,19) |
| InChIKey | HQBYCSCIMKFEHA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|