C13H17N5O3 — CID 106528260
3-[[5-(methylamino)pyrazin-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 106528260) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-[[5-(methylamino)pyrazin-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[5-(methylamino)pyrazin-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 106528260 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-[[5-(methylamino)pyrazin-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CNc1cnc(CN2C(=O)NC3(CCOCC3)C2=O)cn1 |
| InChI | InChI=1S/C13H17N5O3/c1-14-10-7-15-9(6-16-10)8-18-11(19)13(17-12(18)20)2-4-21-5-3-13/h6-7H,2-5,8H2,1H3,(H,14,16)(H,17,20) |
| InChIKey | FIHTWUFMZQOGGA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|