C17H13F2NS — CID 106528366
N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylaniline (PubChem CID 106528366) has the molecular formula C17H13F2NS and a molecular weight of 301.36 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylaniline.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylaniline |
|---|---|
| PubChem CID | 106528366 |
| Molecular Formula | C17H13F2NS |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylaniline |
| SMILES | Fc1cc(F)cc(CNc2ccccc2-c2cccs2)c1 |
| InChI | InChI=1S/C17H13F2NS/c18-13-8-12(9-14(19)10-13)11-20-16-5-2-1-4-15(16)17-6-3-7-21-17/h1-10,20H,11H2 |
| InChIKey | HVKIQAGRWAKYOW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |