About 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide
3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide (PubChem CID 106528429) has the molecular formula C10H14F2N2O2S
and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide |
| PubChem CID | 106528429 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H14F2N2O2S/c11-9-4-8(5-10(12)6-9)7-14-2-1-3-17(13,15)16/h4-6,14H,1-3,7H2,(H2,13,15,16) |
| InChIKey | WKUFRLAHSJRYJB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide?
The IUPAC name of 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide (CID 106528429) is 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide.
What is the SMILES notation for 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide?
The canonical SMILES for 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide is NS(=O)(=O)CCCNCc1cc(F)cc(F)c1.
What is the InChIKey of 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide?
The InChIKey is WKUFRLAHSJRYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O2S/c11-9-4-8(5-10(12)6-9)7-14-2-1-3-17(13,15)16/h4-6,14H,1-3,7H2,(H2,13,15,16).
What are the key properties of 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide?
3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide has a molecular weight of 264.30 g/mol, XLogP of 0.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-difluorophenyl)methylamino]propane-1-sulfonamide is sourced from PubChem (CID 106528429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).