C13H15FN2O3 — CID 106529376
methyl N-[1-(3-fluoro-5-formylphenyl)pyrrolidin-3-yl]carbamate (PubChem CID 106529376) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is methyl N-[1-(3-fluoro-5-formylphenyl)pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-(3-fluoro-5-formylphenyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 106529376 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl N-[1-(3-fluoro-5-formylphenyl)pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(c2cc(F)cc(C=O)c2)C1 |
| InChI | InChI=1S/C13H15FN2O3/c1-19-13(18)15-11-2-3-16(7-11)12-5-9(8-17)4-10(14)6-12/h4-6,8,11H,2-3,7H2,1H3,(H,15,18) |
| InChIKey | PTXWCKOSKLXXBI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|