C17H20FNO2 — CID 106531560
(E)-3-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-fluorophenyl]prop-2-enoic acid (PubChem CID 106531560) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is (E)-3-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106531560 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (E)-3-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)cc(N2CCCC3CCCC32)c1 |
| InChI | InChI=1S/C17H20FNO2/c18-14-9-12(6-7-17(20)21)10-15(11-14)19-8-2-4-13-3-1-5-16(13)19/h6-7,9-11,13,16H,1-5,8H2,(H,20,21)/b7-6+ |
| InChIKey | MUKMKADXNHNODC-VOTSOKGWSA-N |
| XLogP | 3.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|