C11H13F2NS — CID 106531979
2-(3,5-difluorophenyl)-4,4-dimethyl-1,3-thiazolidine (PubChem CID 106531979) has the molecular formula C11H13F2NS and a molecular weight of 229.29 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4,4-dimethyl-1,3-thiazolidine.
| Compound Name | 2-(3,5-difluorophenyl)-4,4-dimethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 106531979 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4,4-dimethyl-1,3-thiazolidine |
| SMILES | CC1(C)CSC(c2cc(F)cc(F)c2)N1 |
| InChI | InChI=1S/C11H13F2NS/c1-11(2)6-15-10(14-11)7-3-8(12)5-9(13)4-7/h3-5,10,14H,6H2,1-2H3 |
| InChIKey | DCGYBSQBSDLALI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |