C56H63NO5Si2 — CID 10653263
benzyl (2R,3S,6S)-3,6-bis[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]octanoate (PubChem CID 10653263) has the molecular formula C56H63NO5Si2 and a molecular weight of 886.29 g/mol. Its IUPAC name is benzyl (2R,3S,6S)-3,6-bis[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]octanoate.
| Compound Name | benzyl (2R,3S,6S)-3,6-bis[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]octanoate |
|---|---|
| PubChem CID | 10653263 |
| Molecular Formula | C56H63NO5Si2 |
| Molecular Weight | 886.29 g/mol |
| Exact Mass | 885.42 |
| IUPAC Name | benzyl (2R,3S,6S)-3,6-bis[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]octanoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)[C@H](CC[C@@H](CC(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C56H63NO5Si2/c1-43(55(60)61-41-44-24-12-6-13-25-44)52(64(4,5)50-34-22-11-23-35-50)38-37-51(63(2,3)49-32-20-10-21-33-49)40-54(59)57-48(36-39-53(57)58)42-62-56(45-26-14-7-15-27-45,46-28-16-8-17-29-46)47-30-18-9-19-31-47/h6-35,43,48,51-52H,36-42H2,1-5H3/t43-,48-,51-,52-/m0/s1 |
| InChIKey | DCPXUWJMCDKXRM-WPODWIMLSA-N |
| XLogP | 11.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.29 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|