C13H14FN3 — CID 106533112
N-[(3-fluoro-5-pyrazol-1-ylphenyl)methyl]cyclopropanamine (PubChem CID 106533112) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is N-[(3-fluoro-5-pyrazol-1-ylphenyl)methyl]cyclopropanamine.
| Compound Name | N-[(3-fluoro-5-pyrazol-1-ylphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106533112 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-[(3-fluoro-5-pyrazol-1-ylphenyl)methyl]cyclopropanamine |
| SMILES | Fc1cc(CNC2CC2)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C13H14FN3/c14-11-6-10(9-15-12-2-3-12)7-13(8-11)17-5-1-4-16-17/h1,4-8,12,15H,2-3,9H2 |
| InChIKey | HSHTYMANXSMUKQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |