About (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine
(2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine (PubChem CID 106534568) has the molecular formula C15H21F2NO
and a molecular weight of 269.33 g/mol. Its IUPAC name is (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine.
Molecular Properties
| Compound Name | (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine |
| PubChem CID | 106534568 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine |
| SMILES | COCCNC/C(=C/c1cc(F)cc(F)c1)C(C)C |
| InChI | InChI=1S/C15H21F2NO/c1-11(2)13(10-18-4-5-19-3)6-12-7-14(16)9-15(17)8-12/h6-9,11,18H,4-5,10H2,1-3H3/b13-6- |
| InChIKey | VCEYUADTAOZBPT-MLPAPPSSSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine?
The IUPAC name of (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine (CID 106534568) is (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine.
What is the SMILES notation for (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine?
The canonical SMILES for (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine is COCCNC/C(=C/c1cc(F)cc(F)c1)C(C)C.
What is the InChIKey of (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine?
The InChIKey is VCEYUADTAOZBPT-MLPAPPSSSA-N. The full InChI is InChI=1S/C15H21F2NO/c1-11(2)13(10-18-4-5-19-3)6-12-7-14(16)9-15(17)8-12/h6-9,11,18H,4-5,10H2,1-3H3/b13-6-.
What are the key properties of (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine?
(2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine has a molecular weight of 269.33 g/mol, XLogP of 3.24, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(3,5-difluorophenyl)methylidene]-N-(2-methoxyethyl)-3-methylbutan-1-amine is sourced from PubChem (CID 106534568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).