About 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide
2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide (PubChem CID 106535186) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide.
Molecular Properties
| Compound Name | 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide |
| PubChem CID | 106535186 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)Nc1nccc2occc12 |
| InChI | InChI=1S/C13H17N3O2/c1-8(2)15-13(17)9(3)16-12-10-5-7-18-11(10)4-6-14-12/h4-9H,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | WLSAWSXXIJMUKO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide?
The IUPAC name of 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide (CID 106535186) is 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide.
What is the SMILES notation for 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide?
The canonical SMILES for 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide is CC(C)NC(=O)C(C)Nc1nccc2occc12.
What is the InChIKey of 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide?
The InChIKey is WLSAWSXXIJMUKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-8(2)15-13(17)9(3)16-12-10-5-7-18-11(10)4-6-14-12/h4-9H,1-3H3,(H,14,16)(H,15,17).
What are the key properties of 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide?
2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide has a molecular weight of 247.30 g/mol, XLogP of 2.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furo[3,2-c]pyridin-4-ylamino)-N-propan-2-ylpropanamide is sourced from PubChem (CID 106535186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).