About N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine
N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine (PubChem CID 106535576) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine |
| PubChem CID | 106535576 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1CCN(c2nccc3occc23)CC1 |
| InChI | InChI=1S/C16H23N3O/c1-2-7-17-12-13-4-9-19(10-5-13)16-14-6-11-20-15(14)3-8-18-16/h3,6,8,11,13,17H,2,4-5,7,9-10,12H2,1H3 |
| InChIKey | WKVQHJKMXDKJRO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine?
The IUPAC name of N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine (CID 106535576) is N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine.
What is the SMILES notation for N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine?
The canonical SMILES for N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine is CCCNCC1CCN(c2nccc3occc23)CC1.
What is the InChIKey of N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine?
The InChIKey is WKVQHJKMXDKJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-2-7-17-12-13-4-9-19(10-5-13)16-14-6-11-20-15(14)3-8-18-16/h3,6,8,11,13,17H,2,4-5,7,9-10,12H2,1H3.
What are the key properties of N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine?
N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine has a molecular weight of 273.38 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)methyl]propan-1-amine is sourced from PubChem (CID 106535576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).