C16H20N2O3 — CID 106536076
methyl 2-[(7-hydroxyisoquinolin-1-yl)amino]-4-methylpentanoate (PubChem CID 106536076) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl 2-[(7-hydroxyisoquinolin-1-yl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(7-hydroxyisoquinolin-1-yl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 106536076 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl 2-[(7-hydroxyisoquinolin-1-yl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)Nc1nccc2ccc(O)cc12 |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)8-14(16(20)21-3)18-15-13-9-12(19)5-4-11(13)6-7-17-15/h4-7,9-10,14,19H,8H2,1-3H3,(H,17,18) |
| InChIKey | JPQMLSGSCWGNME-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |