C14H15NO3S — CID 106536837
3-(5-methoxyisoquinolin-1-yl)sulfanylbutanoic acid (PubChem CID 106536837) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-(5-methoxyisoquinolin-1-yl)sulfanylbutanoic acid.
| Compound Name | 3-(5-methoxyisoquinolin-1-yl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 106536837 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-(5-methoxyisoquinolin-1-yl)sulfanylbutanoic acid |
| SMILES | COc1cccc2c(SC(C)CC(=O)O)nccc12 |
| InChI | InChI=1S/C14H15NO3S/c1-9(8-13(16)17)19-14-11-4-3-5-12(18-2)10(11)6-7-15-14/h3-7,9H,8H2,1-2H3,(H,16,17) |
| InChIKey | LZPDVDKXJJMVMC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |