C15H21N3O — CID 106536904
N'-(6-methoxyisoquinolin-1-yl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 106536904) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N'-(6-methoxyisoquinolin-1-yl)-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-(6-methoxyisoquinolin-1-yl)-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106536904 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N'-(6-methoxyisoquinolin-1-yl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)c1nccc2cc(OC)ccc12 |
| InChI | InChI=1S/C15H21N3O/c1-16-8-4-10-18(2)15-14-6-5-13(19-3)11-12(14)7-9-17-15/h5-7,9,11,16H,4,8,10H2,1-3H3 |
| InChIKey | OGBDEIKJWKSOAR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|