C15H19BrN4O — CID 106537048
3-[(5-bromoisoquinolin-1-yl)-propan-2-ylamino]-N'-hydroxypropanimidamide (PubChem CID 106537048) has the molecular formula C15H19BrN4O and a molecular weight of 351.25 g/mol. Its IUPAC name is 3-[(5-bromoisoquinolin-1-yl)-propan-2-ylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(5-bromoisoquinolin-1-yl)-propan-2-ylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 106537048 |
| Molecular Formula | C15H19BrN4O |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 3-[(5-bromoisoquinolin-1-yl)-propan-2-ylamino]-N'-hydroxypropanimidamide |
| SMILES | CC(C)N(CC/C(N)=N/O)c1nccc2c(Br)cccc12 |
| InChI | InChI=1S/C15H19BrN4O/c1-10(2)20(9-7-14(17)19-21)15-12-4-3-5-13(16)11(12)6-8-18-15/h3-6,8,10,21H,7,9H2,1-2H3,(H2,17,19) |
| InChIKey | OTUPVTWQQUWSDQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|