C16H20N4O — CID 106537108
1-(7-methoxyisoquinolin-1-yl)piperidine-4-carboximidamide (PubChem CID 106537108) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(7-methoxyisoquinolin-1-yl)piperidine-4-carboximidamide.
| Compound Name | 1-(7-methoxyisoquinolin-1-yl)piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 106537108 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(7-methoxyisoquinolin-1-yl)piperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCN(c2nccc3ccc(OC)cc23)CC1 |
| InChI | InChI=1S/C16H20N4O/c1-21-13-3-2-11-4-7-19-16(14(11)10-13)20-8-5-12(6-9-20)15(17)18/h2-4,7,10,12H,5-6,8-9H2,1H3,(H3,17,18) |
| InChIKey | MFHVDAZWAWVTCZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|