C16H20N2O2 — CID 106537238
N-pentan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine (PubChem CID 106537238) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-pentan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine.
| Compound Name | N-pentan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine |
|---|---|
| PubChem CID | 106537238 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-pentan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine |
| SMILES | CCCC(C)Nc1nccc2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C16H20N2O2/c1-3-4-11(2)18-16-13-10-15-14(19-7-8-20-15)9-12(13)5-6-17-16/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | KHQJCGNQUBPXBW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |