C17H17BrN2S — CID 106539136
5-bromo-N-(2-methyl-2-thiophen-2-ylpropyl)isoquinolin-1-amine (PubChem CID 106539136) has the molecular formula C17H17BrN2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 5-bromo-N-(2-methyl-2-thiophen-2-ylpropyl)isoquinolin-1-amine.
| Compound Name | 5-bromo-N-(2-methyl-2-thiophen-2-ylpropyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 106539136 |
| Molecular Formula | C17H17BrN2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 5-bromo-N-(2-methyl-2-thiophen-2-ylpropyl)isoquinolin-1-amine |
| SMILES | CC(C)(CNc1nccc2c(Br)cccc12)c1cccs1 |
| InChI | InChI=1S/C17H17BrN2S/c1-17(2,15-7-4-10-21-15)11-20-16-13-5-3-6-14(18)12(13)8-9-19-16/h3-10H,11H2,1-2H3,(H,19,20) |
| InChIKey | ZKCXALIFHXOXSH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |