About 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline
1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline (PubChem CID 106540282) has the molecular formula C15H18ClNO2S
and a molecular weight of 311.83 g/mol. Its IUPAC name is 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline.
Molecular Properties
| Compound Name | 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline |
| PubChem CID | 106540282 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline |
| SMILES | COc1cc2ccnc(SCC(C)CCl)c2cc1OC |
| InChI | InChI=1S/C15H18ClNO2S/c1-10(8-16)9-20-15-12-7-14(19-3)13(18-2)6-11(12)4-5-17-15/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | PXZIKGBIFNOHNU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline?
The IUPAC name of 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline (CID 106540282) is 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline.
What is the SMILES notation for 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline?
The canonical SMILES for 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline is COc1cc2ccnc(SCC(C)CCl)c2cc1OC.
What is the InChIKey of 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline?
The InChIKey is PXZIKGBIFNOHNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO2S/c1-10(8-16)9-20-15-12-7-14(19-3)13(18-2)6-11(12)4-5-17-15/h4-7,10H,8-9H2,1-3H3.
What are the key properties of 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline?
1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline has a molecular weight of 311.83 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-2-methylpropyl)sulfanyl-6,7-dimethoxyisoquinoline is sourced from PubChem (CID 106540282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).