C15H17N5O — CID 106540865
N-[(5-amino-1-methylpyrazol-4-yl)methyl]-7-methoxyisoquinolin-1-amine (PubChem CID 106540865) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]-7-methoxyisoquinolin-1-amine.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-7-methoxyisoquinolin-1-amine |
|---|---|
| PubChem CID | 106540865 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-7-methoxyisoquinolin-1-amine |
| SMILES | COc1ccc2ccnc(NCc3cnn(C)c3N)c2c1 |
| InChI | InChI=1S/C15H17N5O/c1-20-14(16)11(9-19-20)8-18-15-13-7-12(21-2)4-3-10(13)5-6-17-15/h3-7,9H,8,16H2,1-2H3,(H,17,18) |
| InChIKey | RUQAVLLDYGWOGV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |