C15H19N3O — CID 106540945
1-cyclopropyl-N'-(5-methoxyisoquinolin-1-yl)ethane-1,2-diamine (PubChem CID 106540945) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-cyclopropyl-N'-(5-methoxyisoquinolin-1-yl)ethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N'-(5-methoxyisoquinolin-1-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 106540945 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-cyclopropyl-N'-(5-methoxyisoquinolin-1-yl)ethane-1,2-diamine |
| SMILES | COc1cccc2c(NCC(N)C3CC3)nccc12 |
| InChI | InChI=1S/C15H19N3O/c1-19-14-4-2-3-12-11(14)7-8-17-15(12)18-9-13(16)10-5-6-10/h2-4,7-8,10,13H,5-6,9,16H2,1H3,(H,17,18) |
| InChIKey | MSVUFANUOIYRME-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |