About 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline
1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline (PubChem CID 106542621) has the molecular formula C16H19ClN2O2
and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline.
Molecular Properties
| Compound Name | 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline |
| PubChem CID | 106542621 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline |
| SMILES | COc1cc2ccnc(N3CCC(CCl)C3)c2cc1OC |
| InChI | InChI=1S/C16H19ClN2O2/c1-20-14-7-12-3-5-18-16(13(12)8-15(14)21-2)19-6-4-11(9-17)10-19/h3,5,7-8,11H,4,6,9-10H2,1-2H3 |
| InChIKey | YYPAQHQDCDYZCQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline?
The IUPAC name of 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline (CID 106542621) is 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline.
What is the SMILES notation for 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline?
The canonical SMILES for 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline is COc1cc2ccnc(N3CCC(CCl)C3)c2cc1OC.
What is the InChIKey of 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline?
The InChIKey is YYPAQHQDCDYZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O2/c1-20-14-7-12-3-5-18-16(13(12)8-15(14)21-2)19-6-4-11(9-17)10-19/h3,5,7-8,11H,4,6,9-10H2,1-2H3.
What are the key properties of 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline?
1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline has a molecular weight of 306.79 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(chloromethyl)pyrrolidin-1-yl]-6,7-dimethoxyisoquinoline is sourced from PubChem (CID 106542621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).