About 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide
5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide (PubChem CID 106543940) has the molecular formula C6H8BrF3N4O3S
and a molecular weight of 353.12 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide |
| PubChem CID | 106543940 |
| Molecular Formula | C6H8BrF3N4O3S |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C6H8BrF3N4O3S/c1-14-5(4(7)12-13-14)18(16,17)11-2-3(15)6(8,9)10/h3,11,15H,2H2,1H3 |
| InChIKey | JBMUUFCXZSJWQQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide?
The IUPAC name of 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide (CID 106543940) is 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide.
What is the SMILES notation for 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide?
The canonical SMILES for 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide is Cn1nnc(Br)c1S(=O)(=O)NCC(O)C(F)(F)F.
What is the InChIKey of 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide?
The InChIKey is JBMUUFCXZSJWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrF3N4O3S/c1-14-5(4(7)12-13-14)18(16,17)11-2-3(15)6(8,9)10/h3,11,15H,2H2,1H3.
What are the key properties of 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide?
5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide has a molecular weight of 353.12 g/mol, XLogP of -0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)triazole-4-sulfonamide is sourced from PubChem (CID 106543940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).