About 5-isothiocyanato-1,3-dimethylpyrazole
5-isothiocyanato-1,3-dimethylpyrazole (PubChem CID 10654427) has the molecular formula C6H7N3S
and a molecular weight of 153.21 g/mol. Its IUPAC name is 5-isothiocyanato-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-isothiocyanato-1,3-dimethylpyrazole |
| PubChem CID | 10654427 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 5-isothiocyanato-1,3-dimethylpyrazole |
| SMILES | Cc1cc(N=C=S)n(C)n1 |
| InChI | InChI=1S/C6H7N3S/c1-5-3-6(7-4-10)9(2)8-5/h3H,1-2H3 |
| InChIKey | DOQKYIFHYNIMDJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-isothiocyanato-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isothiocyanato-1,3-dimethylpyrazole?
The IUPAC name of 5-isothiocyanato-1,3-dimethylpyrazole (CID 10654427) is 5-isothiocyanato-1,3-dimethylpyrazole.
What is the SMILES notation for 5-isothiocyanato-1,3-dimethylpyrazole?
The canonical SMILES for 5-isothiocyanato-1,3-dimethylpyrazole is Cc1cc(N=C=S)n(C)n1.
What is the InChIKey of 5-isothiocyanato-1,3-dimethylpyrazole?
The InChIKey is DOQKYIFHYNIMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S/c1-5-3-6(7-4-10)9(2)8-5/h3H,1-2H3.
What are the key properties of 5-isothiocyanato-1,3-dimethylpyrazole?
5-isothiocyanato-1,3-dimethylpyrazole has a molecular weight of 153.21 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isothiocyanato-1,3-dimethylpyrazole is sourced from PubChem (CID 10654427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).