About (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol
(E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol (PubChem CID 10654588) has the molecular formula C9H18O2
and a molecular weight of 164.28 g/mol. Its IUPAC name is (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol |
| PubChem CID | 10654588 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 164.28 g/mol |
| Exact Mass | 164.17 |
| IUPAC Name | (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol |
| SMILES | [2H]C([2H])([2H])C(O)(/C=C/C(C)(C)OC)C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H18O2/c1-8(2,10)6-7-9(3,4)11-5/h6-7,10H,1-5H3/b7-6+/i1D3,2D3 |
| InChIKey | UWCIWHCLZBPPAU-YEQHJJEESA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol?
The IUPAC name of (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol (CID 10654588) is (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol.
What is the SMILES notation for (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol?
The canonical SMILES for (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol is [2H]C([2H])([2H])C(O)(/C=C/C(C)(C)OC)C([2H])([2H])[2H].
What is the InChIKey of (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol?
The InChIKey is UWCIWHCLZBPPAU-YEQHJJEESA-N. The full InChI is InChI=1S/C9H18O2/c1-8(2,10)6-7-9(3,4)11-5/h6-7,10H,1-5H3/b7-6+/i1D3,2D3.
What are the key properties of (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol?
(E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol has a molecular weight of 164.28 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1,1-trideuterio-5-methoxy-5-methyl-2-(trideuteriomethyl)hex-3-en-2-ol is sourced from PubChem (CID 10654588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).