C10H12FN — CID 10654599
3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 10654599) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 10654599 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | FCC1Cc2ccccc2CN1 |
| InChI | InChI=1S/C10H12FN/c11-6-10-5-8-3-1-2-4-9(8)7-12-10/h1-4,10,12H,5-7H2 |
| InChIKey | SLBKHMRNZGCZIO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |