C12H12BrClN2O2S — CID 106546394
3-bromo-4-chloro-N-[(1-methylpyrrol-2-yl)methyl]benzenesulfonamide (PubChem CID 106546394) has the molecular formula C12H12BrClN2O2S and a molecular weight of 363.66 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[(1-methylpyrrol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-[(1-methylpyrrol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106546394 |
| Molecular Formula | C12H12BrClN2O2S |
| Molecular Weight | 363.66 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 3-bromo-4-chloro-N-[(1-methylpyrrol-2-yl)methyl]benzenesulfonamide |
| SMILES | Cn1cccc1CNS(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H12BrClN2O2S/c1-16-6-2-3-9(16)8-15-19(17,18)10-4-5-12(14)11(13)7-10/h2-7,15H,8H2,1H3 |
| InChIKey | AIHYFKASUBTLRV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |