C9H11N3O3S — CID 106546656
2-cyano-N-[(2S)-2-hydroxypropyl]pyridine-3-sulfonamide (PubChem CID 106546656) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-cyano-N-[(2S)-2-hydroxypropyl]pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-[(2S)-2-hydroxypropyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106546656 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-cyano-N-[(2S)-2-hydroxypropyl]pyridine-3-sulfonamide |
| SMILES | C[C@H](O)CNS(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C9H11N3O3S/c1-7(13)6-12-16(14,15)9-3-2-4-11-8(9)5-10/h2-4,7,12-13H,6H2,1H3/t7-/m0/s1 |
| InChIKey | AJQCKRKGDPXZKA-ZETCQYMHSA-N |
| XLogP | -0.39 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |