About methyl 3-acetyl-1,2-oxazole-5-carboxylate
methyl 3-acetyl-1,2-oxazole-5-carboxylate (PubChem CID 10654692) has the molecular formula C7H7NO4
and a molecular weight of 169.14 g/mol. Its IUPAC name is methyl 3-acetyl-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-acetyl-1,2-oxazole-5-carboxylate |
| PubChem CID | 10654692 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | methyl 3-acetyl-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(C(C)=O)no1 |
| InChI | InChI=1S/C7H7NO4/c1-4(9)5-3-6(12-8-5)7(10)11-2/h3H,1-2H3 |
| InChIKey | UJHMNWHOSURUON-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-acetyl-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-acetyl-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl 3-acetyl-1,2-oxazole-5-carboxylate (CID 10654692) is methyl 3-acetyl-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl 3-acetyl-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl 3-acetyl-1,2-oxazole-5-carboxylate is COC(=O)c1cc(C(C)=O)no1.
What is the InChIKey of methyl 3-acetyl-1,2-oxazole-5-carboxylate?
The InChIKey is UJHMNWHOSURUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c1-4(9)5-3-6(12-8-5)7(10)11-2/h3H,1-2H3.
What are the key properties of methyl 3-acetyl-1,2-oxazole-5-carboxylate?
methyl 3-acetyl-1,2-oxazole-5-carboxylate has a molecular weight of 169.14 g/mol, XLogP of 0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-acetyl-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 10654692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).