C12H12N2O4 — CID 106548449
3-methyl-5-[(4-methyl-6-oxopyridazin-1-yl)methyl]furan-2-carboxylic acid (PubChem CID 106548449) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-methyl-5-[(4-methyl-6-oxopyridazin-1-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(4-methyl-6-oxopyridazin-1-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106548449 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-methyl-5-[(4-methyl-6-oxopyridazin-1-yl)methyl]furan-2-carboxylic acid |
| SMILES | Cc1cnn(Cc2cc(C)c(C(=O)O)o2)c(=O)c1 |
| InChI | InChI=1S/C12H12N2O4/c1-7-3-10(15)14(13-5-7)6-9-4-8(2)11(18-9)12(16)17/h3-5H,6H2,1-2H3,(H,16,17) |
| InChIKey | ORXTWUIHUBIBIK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |