C14H15N3O2S — CID 106548705
2-[2-(4-methyl-6-oxopyridazin-1-yl)ethoxy]benzenecarbothioamide (PubChem CID 106548705) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-[2-(4-methyl-6-oxopyridazin-1-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 2-[2-(4-methyl-6-oxopyridazin-1-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 106548705 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[2-(4-methyl-6-oxopyridazin-1-yl)ethoxy]benzenecarbothioamide |
| SMILES | Cc1cnn(CCOc2ccccc2C(N)=S)c(=O)c1 |
| InChI | InChI=1S/C14H15N3O2S/c1-10-8-13(18)17(16-9-10)6-7-19-12-5-3-2-4-11(12)14(15)20/h2-5,8-9H,6-7H2,1H3,(H2,15,20) |
| InChIKey | VDISVEVAMSOPRB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|